C18H23N3O5 — CID 134082880
N-(2-methoxyethyl)-2-[5-methyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide (PubChem CID 134082880) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[5-methyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[5-methyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
|---|---|
| PubChem CID | 134082880 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-[5-methyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
| SMILES | COCCNC(=O)CN1OC2C(=O)N(C)C(=O)C2C1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23N3O5/c1-11-4-6-12(7-5-11)15-14-16(18(24)20(2)17(14)23)26-21(15)10-13(22)19-8-9-25-3/h4-7,14-16H,8-10H2,1-3H3,(H,19,22) |
| InChIKey | AQQCGWRHYGYBOS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|