C26H24N6O2 — CID 134083619
N-[2-(1H-indol-3-yl)-1-(6-methoxy-1-prop-2-enylbenzimidazol-2-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 134083619) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-1-(6-methoxy-1-prop-2-enylbenzimidazol-2-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-1-(6-methoxy-1-prop-2-enylbenzimidazol-2-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134083619 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-1-(6-methoxy-1-prop-2-enylbenzimidazol-2-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | C=CCn1c(C(Cc2c[nH]c3ccccc23)NC(=O)c2cnccn2)nc2ccc(OC)cc21 |
| InChI | InChI=1S/C26H24N6O2/c1-3-12-32-24-14-18(34-2)8-9-21(24)30-25(32)22(31-26(33)23-16-27-10-11-28-23)13-17-15-29-20-7-5-4-6-19(17)20/h3-11,14-16,22,29H,1,12-13H2,2H3,(H,31,33) |
| InChIKey | IFKSVVKGQIPDRM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|