C20H13Cl3N2 — CID 134083955
1-[(3-chlorophenyl)methyl]-2-(2,4-dichlorophenyl)benzimidazole (PubChem CID 134083955) has the molecular formula C20H13Cl3N2 and a molecular weight of 387.70 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-(2,4-dichlorophenyl)benzimidazole.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-(2,4-dichlorophenyl)benzimidazole |
|---|---|
| PubChem CID | 134083955 |
| Molecular Formula | C20H13Cl3N2 |
| Molecular Weight | 387.70 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-(2,4-dichlorophenyl)benzimidazole |
| SMILES | Clc1cccc(Cn2c(-c3ccc(Cl)cc3Cl)nc3ccccc32)c1 |
| InChI | InChI=1S/C20H13Cl3N2/c21-14-5-3-4-13(10-14)12-25-19-7-2-1-6-18(19)24-20(25)16-9-8-15(22)11-17(16)23/h1-11H,12H2 |
| InChIKey | JTXVJJPDUHWVFV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |