About 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol
2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol (PubChem CID 13408397) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol |
| PubChem CID | 13408397 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol |
| SMILES | CCCc1c(-c2ccc(O)cc2)n(CCC)c2ccc(O)cc12 |
| InChI | InChI=1S/C20H23NO2/c1-3-5-17-18-13-16(23)10-11-19(18)21(12-4-2)20(17)14-6-8-15(22)9-7-14/h6-11,13,22-23H,3-5,12H2,1-2H3 |
| InChIKey | VBYQKPXMZLZSOE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol?
The IUPAC name of 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol (CID 13408397) is 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol.
What is the SMILES notation for 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol?
The canonical SMILES for 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol is CCCc1c(-c2ccc(O)cc2)n(CCC)c2ccc(O)cc12.
What is the InChIKey of 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol?
The InChIKey is VBYQKPXMZLZSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2/c1-3-5-17-18-13-16(23)10-11-19(18)21(12-4-2)20(17)14-6-8-15(22)9-7-14/h6-11,13,22-23H,3-5,12H2,1-2H3.
What are the key properties of 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol?
2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol has a molecular weight of 309.41 g/mol, XLogP of 5.08, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-1,3-dipropylindol-5-ol is sourced from PubChem (CID 13408397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).