C15H24FN5O — CID 134086431
1-[(5-tert-butylpyrazolidin-3-yl)methyl]-3-(2-fluoro-3-pyridinyl)-1-methylurea (PubChem CID 134086431) has the molecular formula C15H24FN5O and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-[(5-tert-butylpyrazolidin-3-yl)methyl]-3-(2-fluoro-3-pyridinyl)-1-methylurea.
| Compound Name | 1-[(5-tert-butylpyrazolidin-3-yl)methyl]-3-(2-fluoro-3-pyridinyl)-1-methylurea |
|---|---|
| PubChem CID | 134086431 |
| Molecular Formula | C15H24FN5O |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-[(5-tert-butylpyrazolidin-3-yl)methyl]-3-(2-fluoro-3-pyridinyl)-1-methylurea |
| SMILES | CN(CC1CC(C(C)(C)C)NN1)C(=O)Nc1cccnc1F |
| InChI | InChI=1S/C15H24FN5O/c1-15(2,3)12-8-10(19-20-12)9-21(4)14(22)18-11-6-5-7-17-13(11)16/h5-7,10,12,19-20H,8-9H2,1-4H3,(H,18,22) |
| InChIKey | VCNOWMXEVSBEAJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|