About (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate
(2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate (PubChem CID 134086446) has the molecular formula C13H8FIN2O4
and a molecular weight of 402.12 g/mol. Its IUPAC name is (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate.
Molecular Properties
| Compound Name | (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate |
| PubChem CID | 134086446 |
| Molecular Formula | C13H8FIN2O4 |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1[N+](=O)[O-])Oc1ccccc1I |
| InChI | InChI=1S/C13H8FIN2O4/c14-8-5-6-10(11(7-8)17(19)20)16-13(18)21-12-4-2-1-3-9(12)15/h1-7H,(H,16,18) |
| InChIKey | HPMBZPCCPYWLNO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate?
The IUPAC name of (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate (CID 134086446) is (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate.
What is the SMILES notation for (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate?
The canonical SMILES for (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate is O=C(Nc1ccc(F)cc1[N+](=O)[O-])Oc1ccccc1I.
What is the InChIKey of (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate?
The InChIKey is HPMBZPCCPYWLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FIN2O4/c14-8-5-6-10(11(7-8)17(19)20)16-13(18)21-12-4-2-1-3-9(12)15/h1-7H,(H,16,18).
What are the key properties of (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate?
(2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate has a molecular weight of 402.12 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodophenyl) N-(4-fluoro-2-nitrophenyl)carbamate is sourced from PubChem (CID 134086446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).