C13H15NO4 — CID 134087367
3-(2-methoxyphenyl)-5,5-dimethyl-1,3-oxazinane-2,4-dione (PubChem CID 134087367) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-5,5-dimethyl-1,3-oxazinane-2,4-dione.
| Compound Name | 3-(2-methoxyphenyl)-5,5-dimethyl-1,3-oxazinane-2,4-dione |
|---|---|
| PubChem CID | 134087367 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(2-methoxyphenyl)-5,5-dimethyl-1,3-oxazinane-2,4-dione |
| SMILES | COc1ccccc1N1C(=O)OCC(C)(C)C1=O |
| InChI | InChI=1S/C13H15NO4/c1-13(2)8-18-12(16)14(11(13)15)9-6-4-5-7-10(9)17-3/h4-7H,8H2,1-3H3 |
| InChIKey | GSLSVOQOTIUZFZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |