About [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid
[(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid (PubChem CID 134087622) has the molecular formula C23H20NO4P
and a molecular weight of 405.39 g/mol. Its IUPAC name is [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid.
Molecular Properties
| Compound Name | [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid |
| PubChem CID | 134087622 |
| Molecular Formula | C23H20NO4P |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid |
| SMILES | CCP(=O)(O)C(c1ccc(-c2ccccc2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H20NO4P/c1-2-29(27,28)23(24-21(25)19-10-6-7-11-20(19)22(24)26)18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-15,23H,2H2,1H3,(H,27,28) |
| InChIKey | OKONFAZBZFRYJV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid?
The IUPAC name of [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid (CID 134087622) is [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid.
What is the SMILES notation for [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid?
The canonical SMILES for [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid is CCP(=O)(O)C(c1ccc(-c2ccccc2)cc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid?
The InChIKey is OKONFAZBZFRYJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20NO4P/c1-2-29(27,28)23(24-21(25)19-10-6-7-11-20(19)22(24)26)18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-15,23H,2H2,1H3,(H,27,28).
What are the key properties of [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid?
[(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid has a molecular weight of 405.39 g/mol, XLogP of 4.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,3-dioxoisoindol-2-yl)-(4-phenylphenyl)methyl]-ethylphosphinic acid is sourced from PubChem (CID 134087622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).