C16H10ClFN2O4 — CID 134087623
2-(4-chlorophenoxy)-N-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 134087623) has the molecular formula C16H10ClFN2O4 and a molecular weight of 348.72 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 134087623 |
| Molecular Formula | C16H10ClFN2O4 |
| Molecular Weight | 348.72 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NN1C(=O)c2cccc(F)c2C1=O |
| InChI | InChI=1S/C16H10ClFN2O4/c17-9-4-6-10(7-5-9)24-8-13(21)19-20-15(22)11-2-1-3-12(18)14(11)16(20)23/h1-7H,8H2,(H,19,21) |
| InChIKey | WLTODSVGFMXYRS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|