C10H6Cl2F3N3S — CID 134087867
4-(2,6-dichlorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione (PubChem CID 134087867) has the molecular formula C10H6Cl2F3N3S and a molecular weight of 328.15 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-(2,6-dichlorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 134087867 |
| Molecular Formula | C10H6Cl2F3N3S |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
| SMILES | Cn1nc(C(F)(F)F)n(-c2c(Cl)cccc2Cl)c1=S |
| InChI | InChI=1S/C10H6Cl2F3N3S/c1-17-9(19)18(8(16-17)10(13,14)15)7-5(11)3-2-4-6(7)12/h2-4H,1H3 |
| InChIKey | GEJOSBQMWCBTDL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|