C26H20F2N2O3 — CID 134088011
5-fluoro-10'-(4-fluorophenyl)spiro[1H-indole-3,9'-2,3,4,5,6,7-hexahydroacridine]-1',2,8'-trione (PubChem CID 134088011) has the molecular formula C26H20F2N2O3 and a molecular weight of 446.45 g/mol. Its IUPAC name is 5-fluoro-10'-(4-fluorophenyl)spiro[1H-indole-3,9'-2,3,4,5,6,7-hexahydroacridine]-1',2,8'-trione.
| Compound Name | 5-fluoro-10'-(4-fluorophenyl)spiro[1H-indole-3,9'-2,3,4,5,6,7-hexahydroacridine]-1',2,8'-trione |
|---|---|
| PubChem CID | 134088011 |
| Molecular Formula | C26H20F2N2O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 5-fluoro-10'-(4-fluorophenyl)spiro[1H-indole-3,9'-2,3,4,5,6,7-hexahydroacridine]-1',2,8'-trione |
| SMILES | O=C1CCCC2=C1C1(C(=O)Nc3ccc(F)cc31)C1=C(CCCC1=O)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20F2N2O3/c27-14-7-10-16(11-8-14)30-19-3-1-5-21(31)23(19)26(24-20(30)4-2-6-22(24)32)17-13-15(28)9-12-18(17)29-25(26)33/h7-13H,1-6H2,(H,29,33) |
| InChIKey | DOXKHSPUSBZXFI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |