C25H19ClN6OS2 — CID 134088052
3-[(2-chloroanilino)methyl]-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-1,3,4-oxadiazole-2-thione (PubChem CID 134088052) has the molecular formula C25H19ClN6OS2 and a molecular weight of 519.06 g/mol. Its IUPAC name is 3-[(2-chloroanilino)methyl]-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2-chloroanilino)methyl]-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 134088052 |
| Molecular Formula | C25H19ClN6OS2 |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 3-[(2-chloroanilino)methyl]-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(CSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)nn1CNc1ccccc1Cl |
| InChI | InChI=1S/C25H19ClN6OS2/c26-19-13-7-8-14-20(19)27-16-32-25(34)33-21(31-32)15-35-24-28-22(17-9-3-1-4-10-17)23(29-30-24)18-11-5-2-6-12-18/h1-14,27H,15-16H2 |
| InChIKey | PNGWHHCCWZOFTH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|