About 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide
1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide (PubChem CID 13408902) has the molecular formula C12H15IN2O2
and a molecular weight of 346.17 g/mol. Its IUPAC name is 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide.
Molecular Properties
| Compound Name | 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide |
| PubChem CID | 13408902 |
| Molecular Formula | C12H15IN2O2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide |
| SMILES | C[n+]1ccccc1CCN1C(=O)CCC1=O.[I-] |
| InChI | InChI=1S/C12H15N2O2.HI/c1-13-8-3-2-4-10(13)7-9-14-11(15)5-6-12(14)16;/h2-4,8H,5-7,9H2,1H3;1H/q+1;/p-1 |
| InChIKey | NLYKGFMEGVRLIJ-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide?
The IUPAC name of 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide (CID 13408902) is 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide.
What is the SMILES notation for 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide?
The canonical SMILES for 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide is C[n+]1ccccc1CCN1C(=O)CCC1=O.[I-].
What is the InChIKey of 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide?
The InChIKey is NLYKGFMEGVRLIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H15N2O2.HI/c1-13-8-3-2-4-10(13)7-9-14-11(15)5-6-12(14)16;/h2-4,8H,5-7,9H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide?
1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide has a molecular weight of 346.17 g/mol, XLogP of -2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-methylpyridin-1-ium-2-yl)ethyl]pyrrolidine-2,5-dione iodide is sourced from PubChem (CID 13408902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).