About N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine
N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine (PubChem CID 134090138) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine |
| PubChem CID | 134090138 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine |
| SMILES | CSC1=C(C(C)N(C)C)CC=C1 |
| InChI | InChI=1S/C10H17NS/c1-8(11(2)3)9-6-5-7-10(9)12-4/h5,7-8H,6H2,1-4H3 |
| InChIKey | FJJRQATZBOPIFD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine?
The IUPAC name of N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine (CID 134090138) is N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine.
What is the SMILES notation for N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine?
The canonical SMILES for N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine is CSC1=C(C(C)N(C)C)CC=C1.
What is the InChIKey of N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine?
The InChIKey is FJJRQATZBOPIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-8(11(2)3)9-6-5-7-10(9)12-4/h5,7-8H,6H2,1-4H3.
What are the key properties of N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine?
N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine has a molecular weight of 183.32 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(2-methylsulfanylcyclopenta-1,3-dien-1-yl)ethanamine is sourced from PubChem (CID 134090138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).