About [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone
[3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone (PubChem CID 13409102) has the molecular formula C23H29NO
and a molecular weight of 335.49 g/mol. Its IUPAC name is [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone |
| PubChem CID | 13409102 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone |
| SMILES | CC(CN1C(C)CCCC1C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H29NO/c1-17(16-24-18(2)9-7-10-19(24)3)21-13-8-14-22(15-21)23(25)20-11-5-4-6-12-20/h4-6,8,11-15,17-19H,7,9-10,16H2,1-3H3 |
| InChIKey | MSOLWIXKJYSHSW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone?
The IUPAC name of [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone (CID 13409102) is [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone.
What is the SMILES notation for [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone?
The canonical SMILES for [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone is CC(CN1C(C)CCCC1C)c1cccc(C(=O)c2ccccc2)c1.
What is the InChIKey of [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone?
The InChIKey is MSOLWIXKJYSHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO/c1-17(16-24-18(2)9-7-10-19(24)3)21-13-8-14-22(15-21)23(25)20-11-5-4-6-12-20/h4-6,8,11-15,17-19H,7,9-10,16H2,1-3H3.
What are the key properties of [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone?
[3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone has a molecular weight of 335.49 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-(2,6-dimethylpiperidin-1-yl)propan-2-yl]phenyl]-phenylmethanone is sourced from PubChem (CID 13409102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).