C18H22FN3O4 — CID 134091710
1-(2,3-dihydroxypropyl)-3-(5-fluoro-2-hydroxyphenyl)-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 134091710) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-(5-fluoro-2-hydroxyphenyl)-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydroxypropyl)-3-(5-fluoro-2-hydroxyphenyl)-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 134091710 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-(5-fluoro-2-hydroxyphenyl)-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | COc1ccccc1C/N=C(\NCC(O)CO)Nc1cc(F)ccc1O |
| InChI | InChI=1S/C18H22FN3O4/c1-26-17-5-3-2-4-12(17)9-20-18(21-10-14(24)11-23)22-15-8-13(19)6-7-16(15)25/h2-8,14,23-25H,9-11H2,1H3,(H2,20,21,22) |
| InChIKey | WIHLJALULBVLPD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|