C22H35Cl2N5 — CID 134091807
1-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 134091807) has the molecular formula C22H35Cl2N5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 134091807 |
| Molecular Formula | C22H35Cl2N5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CC1CCCCN1CCC/N=C(/Nc1ccc(Cl)cc1Cl)N[C@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C22H35Cl2N5/c1-16-7-4-5-13-29(16)14-6-12-26-22(28-21-9-3-2-8-19(21)25)27-20-11-10-17(23)15-18(20)24/h10-11,15-16,19,21H,2-9,12-14,25H2,1H3,(H2,26,27,28)/t16?,19-,21-/m0/s1 |
| InChIKey | CEHOELHRBNMWBD-BPWGJPQNSA-N |
| XLogP | 4.89 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|