About 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid
4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid (PubChem CID 134092149) has the molecular formula C21H18F2N2O3
and a molecular weight of 384.38 g/mol. Its IUPAC name is 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid |
| PubChem CID | 134092149 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1cc(-c2cc(F)ccc2F)cc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C21H18F2N2O3/c22-15-6-7-18(23)17(12-15)14-10-19(13-3-1-4-16(26)9-13)25-20(11-14)24-8-2-5-21(27)28/h1,3-4,6-7,9-12,26H,2,5,8H2,(H,24,25)(H,27,28) |
| InChIKey | OTMMDGNTMXLLDG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid?
The IUPAC name of 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid (CID 134092149) is 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid.
What is the SMILES notation for 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid?
The canonical SMILES for 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid is O=C(O)CCCNc1cc(-c2cc(F)ccc2F)cc(-c2cccc(O)c2)n1.
What is the InChIKey of 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid?
The InChIKey is OTMMDGNTMXLLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N2O3/c22-15-6-7-18(23)17(12-15)14-10-19(13-3-1-4-16(26)9-13)25-20(11-14)24-8-2-5-21(27)28/h1,3-4,6-7,9-12,26H,2,5,8H2,(H,24,25)(H,27,28).
What are the key properties of 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid?
4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid has a molecular weight of 384.38 g/mol, XLogP of 4.68, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,5-difluorophenyl)-6-(3-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid is sourced from PubChem (CID 134092149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).