C18H16ClF4NOS — CID 134092373
N-[(4-chlorophenyl)methyl]-2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanylpropanamide (PubChem CID 134092373) has the molecular formula C18H16ClF4NOS and a molecular weight of 405.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 134092373 |
| Molecular Formula | C18H16ClF4NOS |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanylpropanamide |
| SMILES | CC(C)(CSc1c(F)c(F)cc(F)c1F)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClF4NOS/c1-18(2,17(25)24-8-10-3-5-11(19)6-4-10)9-26-16-14(22)12(20)7-13(21)15(16)23/h3-7H,8-9H2,1-2H3,(H,24,25) |
| InChIKey | JRMBFFMQULTOCC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|