About 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid
4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid (PubChem CID 13409291) has the molecular formula C24H23NO4
and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid |
| PubChem CID | 13409291 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid |
| SMILES | CCn1c(-c2ccccc2)c(C2=CCC(C(=O)O)(C(=O)O)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H23NO4/c1-2-25-19-11-7-6-10-18(19)20(21(25)17-8-4-3-5-9-17)16-12-14-24(15-13-16,22(26)27)23(28)29/h3-12H,2,13-15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | TVQSDSZYARQVOT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid?
The IUPAC name of 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid (CID 13409291) is 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid.
What is the SMILES notation for 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid?
The canonical SMILES for 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid is CCn1c(-c2ccccc2)c(C2=CCC(C(=O)O)(C(=O)O)CC2)c2ccccc21.
What is the InChIKey of 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid?
The InChIKey is TVQSDSZYARQVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO4/c1-2-25-19-11-7-6-10-18(19)20(21(25)17-8-4-3-5-9-17)16-12-14-24(15-13-16,22(26)27)23(28)29/h3-12H,2,13-15H2,1H3,(H,26,27)(H,28,29).
What are the key properties of 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid?
4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid has a molecular weight of 389.45 g/mol, XLogP of 5.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethyl-2-phenylindol-3-yl)cyclohex-3-ene-1,1-dicarboxylic acid is sourced from PubChem (CID 13409291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).