C23H23NO4 — CID 13409293
4-(1-methyl-2-phenylindol-3-yl)cyclohexane-1,1-dicarboxylic acid (PubChem CID 13409293) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(1-methyl-2-phenylindol-3-yl)cyclohexane-1,1-dicarboxylic acid.
| Compound Name | 4-(1-methyl-2-phenylindol-3-yl)cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 13409293 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-(1-methyl-2-phenylindol-3-yl)cyclohexane-1,1-dicarboxylic acid |
| SMILES | Cn1c(-c2ccccc2)c(C2CCC(C(=O)O)(C(=O)O)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H23NO4/c1-24-18-10-6-5-9-17(18)19(20(24)16-7-3-2-4-8-16)15-11-13-23(14-12-15,21(25)26)22(27)28/h2-10,15H,11-14H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | IKEDBWCEDOXZQY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|