About 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one
3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 134093690) has the molecular formula C24H15Cl2NO2
and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| PubChem CID | 134093690 |
| Molecular Formula | C24H15Cl2NO2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)c1c(-c2ccccc2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C24H15Cl2NO2/c25-18-11-6-9-16(23(18)26)13-14-20(28)22-21(15-7-2-1-3-8-15)17-10-4-5-12-19(17)27-24(22)29/h1-14H,(H,27,29)/b14-13+ |
| InChIKey | KAXIITIEHCHCDW-BUHFOSPRSA-N |
| XLogP | 6.40 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The IUPAC name of 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (CID 134093690) is 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
What is the SMILES notation for 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The canonical SMILES for 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one is O=C(/C=C/c1cccc(Cl)c1Cl)c1c(-c2ccccc2)c2ccccc2[nH]c1=O.
What is the InChIKey of 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The InChIKey is KAXIITIEHCHCDW-BUHFOSPRSA-N. The full InChI is InChI=1S/C24H15Cl2NO2/c25-18-11-6-9-16(23(18)26)13-14-20(28)22-21(15-7-2-1-3-8-15)17-10-4-5-12-19(17)27-24(22)29/h1-14H,(H,27,29)/b14-13+.
What are the key properties of 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one has a molecular weight of 420.30 g/mol, XLogP of 6.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one is sourced from PubChem (CID 134093690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).