C9H11N3O4S — CID 134093894
6,7-dimethoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine (PubChem CID 134093894) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 6,7-dimethoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine.
| Compound Name | 6,7-dimethoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine |
|---|---|
| PubChem CID | 134093894 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 6,7-dimethoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine |
| SMILES | COc1cc2c(cc1OC)S(=O)(=O)N=C(N)N2 |
| InChI | InChI=1S/C9H11N3O4S/c1-15-6-3-5-8(4-7(6)16-2)17(13,14)12-9(10)11-5/h3-4H,1-2H3,(H3,10,11,12) |
| InChIKey | IABQVXSVYUKAIA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |