About 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine
6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine (PubChem CID 13409410) has the molecular formula C14H12ClNO
and a molecular weight of 245.71 g/mol. Its IUPAC name is 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine.
Molecular Properties
| Compound Name | 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine |
| PubChem CID | 13409410 |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine |
| SMILES | Clc1cccc2c1Oc1ccccc1CCN2 |
| InChI | InChI=1S/C14H12ClNO/c15-11-5-3-6-12-14(11)17-13-7-2-1-4-10(13)8-9-16-12/h1-7,16H,8-9H2 |
| InChIKey | SGEMEEBUUPKLGJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine?
The IUPAC name of 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine (CID 13409410) is 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine.
What is the SMILES notation for 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine?
The canonical SMILES for 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine is Clc1cccc2c1Oc1ccccc1CCN2.
What is the InChIKey of 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine?
The InChIKey is SGEMEEBUUPKLGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO/c15-11-5-3-6-12-14(11)17-13-7-2-1-4-10(13)8-9-16-12/h1-7,16H,8-9H2.
What are the key properties of 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine?
6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine has a molecular weight of 245.71 g/mol, XLogP of 4.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-11,12-dihydro-10H-benzo[b][1,6]benzoxazocine is sourced from PubChem (CID 13409410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).