C27H28N3O4- — CID 134094126
(6Z)-2-methoxycarbonyl-3,3-dimethyl-5-oxo-6-[1-(2-phenanthridin-6-ylhydrazinyl)butylidene]cyclohexen-1-olate (PubChem CID 134094126) has the molecular formula C27H28N3O4- and a molecular weight of 458.54 g/mol. Its IUPAC name is (6Z)-2-methoxycarbonyl-3,3-dimethyl-5-oxo-6-[1-(2-phenanthridin-6-ylhydrazinyl)butylidene]cyclohexen-1-olate.
| Compound Name | (6Z)-2-methoxycarbonyl-3,3-dimethyl-5-oxo-6-[1-(2-phenanthridin-6-ylhydrazinyl)butylidene]cyclohexen-1-olate |
|---|---|
| PubChem CID | 134094126 |
| Molecular Formula | C27H28N3O4- |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (6Z)-2-methoxycarbonyl-3,3-dimethyl-5-oxo-6-[1-(2-phenanthridin-6-ylhydrazinyl)butylidene]cyclohexen-1-olate |
| SMILES | CCC/C(NNc1nc2ccccc2c2ccccc12)=C1/C(=O)CC(C)(C)C(C(=O)OC)=C1[O-] |
| InChI | InChI=1S/C27H29N3O4/c1-5-10-20(22-21(31)15-27(2,3)23(24(22)32)26(33)34-4)29-30-25-18-13-7-6-11-16(18)17-12-8-9-14-19(17)28-25/h6-9,11-14,29,32H,5,10,15H2,1-4H3,(H,28,30)/p-1/b22-20+ |
| InChIKey | KICJGPKWDOTSKD-LSDHQDQOSA-M |
| XLogP | 4.15 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|