About [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate
[2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate (PubChem CID 134095157) has the molecular formula C11H11ClF3NO2
and a molecular weight of 281.66 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate |
| PubChem CID | 134095157 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC(C)(c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c1-10(11(13,14)15,18-9(17)16-2)7-4-3-5-8(12)6-7/h3-6H,1-2H3,(H,16,17) |
| InChIKey | JQPSHGAEWRXNNL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate?
The IUPAC name of [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate (CID 134095157) is [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate.
What is the SMILES notation for [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate?
The canonical SMILES for [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate is CNC(=O)OC(C)(c1cccc(Cl)c1)C(F)(F)F.
What is the InChIKey of [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate?
The InChIKey is JQPSHGAEWRXNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3NO2/c1-10(11(13,14)15,18-9(17)16-2)7-4-3-5-8(12)6-7/h3-6H,1-2H3,(H,16,17).
What are the key properties of [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate?
[2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate has a molecular weight of 281.66 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenyl)-1,1,1-trifluoropropan-2-yl] N-methylcarbamate is sourced from PubChem (CID 134095157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).