C16H11Cl2N3O3 — CID 134095345
2-[4-(2,4-dichlorophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 134095345) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-(2,4-dichlorophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 134095345 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 2-[4-(2,4-dichlorophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(-c2ccc(Oc3ccc(Cl)cc3Cl)cc2)c1=O |
| InChI | InChI=1S/C16H11Cl2N3O3/c1-20-15(22)9-19-21(16(20)23)11-3-5-12(6-4-11)24-14-7-2-10(17)8-13(14)18/h2-9H,1H3 |
| InChIKey | UVFWZHMKJLBFGM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |