About [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate
[3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate (PubChem CID 134095431) has the molecular formula C13H14F3NO4
and a molecular weight of 305.25 g/mol. Its IUPAC name is [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate |
| PubChem CID | 134095431 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate |
| SMILES | CCOC1(C(F)(F)F)OCc2ccc(OC(=O)NC)cc21 |
| InChI | InChI=1S/C13H14F3NO4/c1-3-19-12(13(14,15)16)10-6-9(21-11(18)17-2)5-4-8(10)7-20-12/h4-6H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | FRUCZWMJKNOYRP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate?
The IUPAC name of [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate (CID 134095431) is [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate.
What is the SMILES notation for [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate?
The canonical SMILES for [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate is CCOC1(C(F)(F)F)OCc2ccc(OC(=O)NC)cc21.
What is the InChIKey of [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate?
The InChIKey is FRUCZWMJKNOYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO4/c1-3-19-12(13(14,15)16)10-6-9(21-11(18)17-2)5-4-8(10)7-20-12/h4-6H,3,7H2,1-2H3,(H,17,18).
What are the key properties of [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate?
[3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate has a molecular weight of 305.25 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethoxy-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylcarbamate is sourced from PubChem (CID 134095431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).