C16H16ClN3 — CID 134095785
4-[(E,3E)-3-[(3-chloro-2-pyridinyl)imino]prop-1-enyl]-N,N-dimethylaniline (PubChem CID 134095785) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-[(E,3E)-3-[(3-chloro-2-pyridinyl)imino]prop-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E,3E)-3-[(3-chloro-2-pyridinyl)imino]prop-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 134095785 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[(E,3E)-3-[(3-chloro-2-pyridinyl)imino]prop-1-enyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=N/c2ncccc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3/c1-20(2)14-9-7-13(8-10-14)5-3-11-18-16-15(17)6-4-12-19-16/h3-12H,1-2H3/b5-3+,18-11+ |
| InChIKey | UEKQKUGBBMDTCJ-DXVNTNFESA-N |
| XLogP | 4.22 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|