About 1-(benzenesulfonyl)-3a,7a-dihydroindole
1-(benzenesulfonyl)-3a,7a-dihydroindole (PubChem CID 134096252) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3a,7a-dihydroindole.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3a,7a-dihydroindole |
| PubChem CID | 134096252 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-(benzenesulfonyl)-3a,7a-dihydroindole |
| SMILES | O=S(=O)(c1ccccc1)N1C=CC2C=CC=CC21 |
| InChI | InChI=1S/C14H13NO2S/c16-18(17,13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)15/h1-12,14H |
| InChIKey | HBJPIVKBVCDBEA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(benzenesulfonyl)-3a,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3a,7a-dihydroindole?
The IUPAC name of 1-(benzenesulfonyl)-3a,7a-dihydroindole (CID 134096252) is 1-(benzenesulfonyl)-3a,7a-dihydroindole.
What is the SMILES notation for 1-(benzenesulfonyl)-3a,7a-dihydroindole?
The canonical SMILES for 1-(benzenesulfonyl)-3a,7a-dihydroindole is O=S(=O)(c1ccccc1)N1C=CC2C=CC=CC21.
What is the InChIKey of 1-(benzenesulfonyl)-3a,7a-dihydroindole?
The InChIKey is HBJPIVKBVCDBEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c16-18(17,13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)15/h1-12,14H.
What are the key properties of 1-(benzenesulfonyl)-3a,7a-dihydroindole?
1-(benzenesulfonyl)-3a,7a-dihydroindole has a molecular weight of 259.33 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3a,7a-dihydroindole is sourced from PubChem (CID 134096252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).