C14H13N3O — CID 134097396
2-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedinitrile (PubChem CID 134097396) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 134097396 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedinitrile |
| SMILES | COc1ccc2c(c1)CCCN2C=C(C#N)C#N |
| InChI | InChI=1S/C14H13N3O/c1-18-13-4-5-14-12(7-13)3-2-6-17(14)10-11(8-15)9-16/h4-5,7,10H,2-3,6H2,1H3 |
| InChIKey | OBOSLUDTCJWCGP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|