About [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate
[[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate (PubChem CID 134097621) has the molecular formula C13H16N2O3S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate |
| PubChem CID | 134097621 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C1CSC(c2ccc(OC)cc2)SC1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-14-13(16)18-15-10-7-19-12(20-8-10)9-3-5-11(17-2)6-4-9/h3-6,12H,7-8H2,1-2H3,(H,14,16)/b15-10- |
| InChIKey | NOYXCCQQCYHGKM-GDNBJRDFSA-N |
| XLogP | 2.89 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate?
The IUPAC name of [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate (CID 134097621) is [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate.
What is the SMILES notation for [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate?
The canonical SMILES for [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate is CNC(=O)ON=C1CSC(c2ccc(OC)cc2)SC1.
What is the InChIKey of [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate?
The InChIKey is NOYXCCQQCYHGKM-GDNBJRDFSA-N. The full InChI is InChI=1S/C13H16N2O3S2/c1-14-13(16)18-15-10-7-19-12(20-8-10)9-3-5-11(17-2)6-4-9/h3-6,12H,7-8H2,1-2H3,(H,14,16)/b15-10-.
What are the key properties of [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate?
[[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate has a molecular weight of 312.42 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(4-methoxyphenyl)-1,3-dithian-5-ylidene]amino] N-methylcarbamate is sourced from PubChem (CID 134097621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).