C10H14ClN3O2 — CID 134098121
1-(2-chloro-4-pyridinyl)-3-(3-methoxypropyl)urea (PubChem CID 134098121) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-(3-methoxypropyl)urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 134098121 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H14ClN3O2/c1-16-6-2-4-13-10(15)14-8-3-5-12-9(11)7-8/h3,5,7H,2,4,6H2,1H3,(H2,12,13,14,15) |
| InChIKey | HYOFBMGXWSJLRO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|