C17H15O3S- — CID 134098337
(1Z,3E)-1-(4-methylphenyl)sulfonyl-4-phenylbuta-1,3-dien-2-olate (PubChem CID 134098337) has the molecular formula C17H15O3S- and a molecular weight of 299.37 g/mol. Its IUPAC name is (1Z,3E)-1-(4-methylphenyl)sulfonyl-4-phenylbuta-1,3-dien-2-olate.
| Compound Name | (1Z,3E)-1-(4-methylphenyl)sulfonyl-4-phenylbuta-1,3-dien-2-olate |
|---|---|
| PubChem CID | 134098337 |
| Molecular Formula | C17H15O3S- |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (1Z,3E)-1-(4-methylphenyl)sulfonyl-4-phenylbuta-1,3-dien-2-olate |
| SMILES | Cc1ccc(S(=O)(=O)/C=C([O-])/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16O3S/c1-14-7-11-17(12-8-14)21(19,20)13-16(18)10-9-15-5-3-2-4-6-15/h2-13,18H,1H3/p-1/b10-9+,16-13- |
| InChIKey | QNWRWCADPSZARR-ZDHWLGKOSA-M |
| XLogP | 2.68 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|