About 2-amino-6-hydroxybenzoic acid;hydrochloride
2-amino-6-hydroxybenzoic acid;hydrochloride (PubChem CID 13409834) has the molecular formula C7H8ClNO3
and a molecular weight of 189.60 g/mol. Its IUPAC name is 2-amino-6-hydroxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-6-hydroxybenzoic acid;hydrochloride |
| PubChem CID | 13409834 |
| Molecular Formula | C7H8ClNO3 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 2-amino-6-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.Nc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C7H7NO3.ClH/c8-4-2-1-3-5(9)6(4)7(10)11;/h1-3,9H,8H2,(H,10,11);1H |
| InChIKey | DGCYGOCSZPAMTE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-hydroxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-hydroxybenzoic acid;hydrochloride?
The IUPAC name of 2-amino-6-hydroxybenzoic acid;hydrochloride (CID 13409834) is 2-amino-6-hydroxybenzoic acid;hydrochloride.
What is the SMILES notation for 2-amino-6-hydroxybenzoic acid;hydrochloride?
The canonical SMILES for 2-amino-6-hydroxybenzoic acid;hydrochloride is Cl.Nc1cccc(O)c1C(=O)O.
What is the InChIKey of 2-amino-6-hydroxybenzoic acid;hydrochloride?
The InChIKey is DGCYGOCSZPAMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.ClH/c8-4-2-1-3-5(9)6(4)7(10)11;/h1-3,9H,8H2,(H,10,11);1H.
What are the key properties of 2-amino-6-hydroxybenzoic acid;hydrochloride?
2-amino-6-hydroxybenzoic acid;hydrochloride has a molecular weight of 189.60 g/mol, XLogP of 1.09, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-hydroxybenzoic acid;hydrochloride is sourced from PubChem (CID 13409834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).