C28H34N4O — CID 134099549
N'-[[4-(aminomethyl)phenyl]methyl]-N-(2-methoxy-5-phenylphenyl)-2-methylpiperidine-1-carboximidamide (PubChem CID 134099549) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is N'-[[4-(aminomethyl)phenyl]methyl]-N-(2-methoxy-5-phenylphenyl)-2-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[4-(aminomethyl)phenyl]methyl]-N-(2-methoxy-5-phenylphenyl)-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134099549 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N'-[[4-(aminomethyl)phenyl]methyl]-N-(2-methoxy-5-phenylphenyl)-2-methylpiperidine-1-carboximidamide |
| SMILES | COc1ccc(-c2ccccc2)cc1N/C(=N/Cc1ccc(CN)cc1)N1CCCCC1C |
| InChI | InChI=1S/C28H34N4O/c1-21-8-6-7-17-32(21)28(30-20-23-13-11-22(19-29)12-14-23)31-26-18-25(15-16-27(26)33-2)24-9-4-3-5-10-24/h3-5,9-16,18,21H,6-8,17,19-20,29H2,1-2H3,(H,30,31) |
| InChIKey | CGPURQLLLAVWDR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|