C16H15Cl2NO3 — CID 134100182
6-(3,5-dichlorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid (PubChem CID 134100182) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 6-(3,5-dichlorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid.
| Compound Name | 6-(3,5-dichlorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 134100182 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 6-(3,5-dichlorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
| SMILES | CC1=CC(C)C2C(=O)N(c3cc(Cl)cc(Cl)c3)C1C2C(=O)O |
| InChI | InChI=1S/C16H15Cl2NO3/c1-7-3-8(2)14-13(16(21)22)12(7)15(20)19(14)11-5-9(17)4-10(18)6-11/h3-7,12-14H,1-2H3,(H,21,22) |
| InChIKey | PYPRUSPEJUTLDH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|