C11H8Cl2N2O — CID 134102114
3-[(2,3-dichlorophenyl)methoxy]pyridazine (PubChem CID 134102114) has the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methoxy]pyridazine.
| Compound Name | 3-[(2,3-dichlorophenyl)methoxy]pyridazine |
|---|---|
| PubChem CID | 134102114 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methoxy]pyridazine |
| SMILES | Clc1cccc(COc2cccnn2)c1Cl |
| InChI | InChI=1S/C11H8Cl2N2O/c12-9-4-1-3-8(11(9)13)7-16-10-5-2-6-14-15-10/h1-6H,7H2 |
| InChIKey | LBMGUMAFTBZHSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |