C17H12ClN3OS2 — CID 134102173
3-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-4-phenyl-1,3-thiazolidin-2-one (PubChem CID 134102173) has the molecular formula C17H12ClN3OS2 and a molecular weight of 373.89 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-4-phenyl-1,3-thiazolidin-2-one.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-4-phenyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 134102173 |
| Molecular Formula | C17H12ClN3OS2 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-4-phenyl-1,3-thiazolidin-2-one |
| SMILES | O=C1SCC(c2ccccc2)N1c1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C17H12ClN3OS2/c18-13-9-5-4-8-12(13)15-19-20-16(24-15)21-14(10-23-17(21)22)11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | OFCHFLVROUOVRN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|