C9H5ClFN3O3 — CID 134102883
2-(4-chloro-2-fluoro-6-hydroxyphenyl)-1,2,4-triazine-3,5-dione (PubChem CID 134102883) has the molecular formula C9H5ClFN3O3 and a molecular weight of 257.61 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-6-hydroxyphenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(4-chloro-2-fluoro-6-hydroxyphenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 134102883 |
| Molecular Formula | C9H5ClFN3O3 |
| Molecular Weight | 257.61 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 2-(4-chloro-2-fluoro-6-hydroxyphenyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2c(O)cc(Cl)cc2F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H5ClFN3O3/c10-4-1-5(11)8(6(15)2-4)14-9(17)13-7(16)3-12-14/h1-3,15H,(H,13,16,17) |
| InChIKey | IICFMFSLSZIRGO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.61 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |