C14H22N2S — CID 134103650
N-(2-bicyclo[2.2.1]hept-5-enyl)-4-methylpiperidine-1-carbothioamide (PubChem CID 134103650) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enyl)-4-methylpiperidine-1-carbothioamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-4-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 134103650 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-4-methylpiperidine-1-carbothioamide |
| SMILES | CC1CCN(C(=S)NC2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C14H22N2S/c1-10-4-6-16(7-5-10)14(17)15-13-9-11-2-3-12(13)8-11/h2-3,10-13H,4-9H2,1H3,(H,15,17) |
| InChIKey | GKOWXPPMMAJMOI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|