C9HClF4N2O2S — CID 134104511
3-chloro-5-(2,3,5,6-tetrafluorophenoxy)-1,2,6-thiadiazin-4-one (PubChem CID 134104511) has the molecular formula C9HClF4N2O2S and a molecular weight of 312.63 g/mol. Its IUPAC name is 3-chloro-5-(2,3,5,6-tetrafluorophenoxy)-1,2,6-thiadiazin-4-one.
| Compound Name | 3-chloro-5-(2,3,5,6-tetrafluorophenoxy)-1,2,6-thiadiazin-4-one |
|---|---|
| PubChem CID | 134104511 |
| Molecular Formula | C9HClF4N2O2S |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 3-chloro-5-(2,3,5,6-tetrafluorophenoxy)-1,2,6-thiadiazin-4-one |
| SMILES | O=c1c(Cl)nsnc1Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9HClF4N2O2S/c10-8-6(17)9(16-19-15-8)18-7-4(13)2(11)1-3(12)5(7)14/h1H |
| InChIKey | LPVRMHXRENIVET-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|