About [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate
[(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate (PubChem CID 134105156) has the molecular formula C9H20ClN3O4
and a molecular weight of 269.73 g/mol. Its IUPAC name is [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate.
Molecular Properties
| Compound Name | [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
| PubChem CID | 134105156 |
| Molecular Formula | C9H20ClN3O4 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
| SMILES | CN(C)/C=C(/C=[N+](C)C)N(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C9H20N3.ClHO4/c1-10(2)7-9(12(5)6)8-11(3)4;2-1(3,4)5/h7-8H,1-6H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CSAZFSXWSPRINE-UHFFFAOYSA-M |
| XLogP | -4.46 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate?
The IUPAC name of [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate (CID 134105156) is [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate.
What is the SMILES notation for [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate?
The canonical SMILES for [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate is CN(C)/C=C(/C=[N+](C)C)N(C)C.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate?
The InChIKey is CSAZFSXWSPRINE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N3.ClHO4/c1-10(2)7-9(12(5)6)8-11(3)4;2-1(3,4)5/h7-8H,1-6H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate?
[(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate has a molecular weight of 269.73 g/mol, XLogP of -4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate is sourced from PubChem (CID 134105156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).