C15H20O — CID 134106167
2,5,5,8,8-pentamethyldeca-3,6,9-triyn-2-ol (PubChem CID 134106167) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2,5,5,8,8-pentamethyldeca-3,6,9-triyn-2-ol.
| Compound Name | 2,5,5,8,8-pentamethyldeca-3,6,9-triyn-2-ol |
|---|---|
| PubChem CID | 134106167 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,5,5,8,8-pentamethyldeca-3,6,9-triyn-2-ol |
| SMILES | C#CC(C)(C)C#CC(C)(C)C#CC(C)(C)O |
| InChI | InChI=1S/C15H20O/c1-8-13(2,3)9-10-14(4,5)11-12-15(6,7)16/h1,16H,2-7H3 |
| InChIKey | IJUCDNHTDUXDMP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|