About 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (PubChem CID 134106267) has the molecular formula C11H10ClN
and a molecular weight of 191.66 g/mol. Its IUPAC name is 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
Analyze 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile?
The IUPAC name of 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (CID 134106267) is 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
What is the SMILES notation for 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile?
The canonical SMILES for 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is N#CC1CCCc2c(Cl)cccc21.
What is the InChIKey of 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile?
The InChIKey is JXEANNIVBZLZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h2,4,6,8H,1,3,5H2.
What are the key properties of 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile?
5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile has a molecular weight of 191.66 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is sourced from PubChem (CID 134106267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).