C12H16N2O2Si — CID 134106929
5-phenyl-3-(trimethylsilylmethyl)-1,3,4-oxadiazol-2-one (PubChem CID 134106929) has the molecular formula C12H16N2O2Si and a molecular weight of 248.36 g/mol. Its IUPAC name is 5-phenyl-3-(trimethylsilylmethyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 5-phenyl-3-(trimethylsilylmethyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 134106929 |
| Molecular Formula | C12H16N2O2Si |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-phenyl-3-(trimethylsilylmethyl)-1,3,4-oxadiazol-2-one |
| SMILES | C[Si](C)(C)Cn1nc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C12H16N2O2Si/c1-17(2,3)9-14-12(15)16-11(13-14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | PSMRSQRSZOFPLW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|