C18H21N5O2 — CID 134107004
6,6-dimethyl-1-[(4-phenoxyphenyl)methoxy]-1,3,5-triazine-2,4-diamine (PubChem CID 134107004) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 6,6-dimethyl-1-[(4-phenoxyphenyl)methoxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-[(4-phenoxyphenyl)methoxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134107004 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 6,6-dimethyl-1-[(4-phenoxyphenyl)methoxy]-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N5O2/c1-18(2)22-16(19)21-17(20)23(18)24-12-13-8-10-15(11-9-13)25-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | ZCLGPBBNPQDOKH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |