About 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile
2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile (PubChem CID 134107227) has the molecular formula C15H13Cl2NS2
and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile |
| PubChem CID | 134107227 |
| Molecular Formula | C15H13Cl2NS2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile |
| SMILES | CCCCSc1scc(-c2ccc(Cl)c(Cl)c2)c1C#N |
| InChI | InChI=1S/C15H13Cl2NS2/c1-2-3-6-19-15-11(8-18)12(9-20-15)10-4-5-13(16)14(17)7-10/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | JDRNJSLLEMJLQM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile?
The IUPAC name of 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile (CID 134107227) is 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile.
What is the SMILES notation for 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile?
The canonical SMILES for 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile is CCCCSc1scc(-c2ccc(Cl)c(Cl)c2)c1C#N.
What is the InChIKey of 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile?
The InChIKey is JDRNJSLLEMJLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NS2/c1-2-3-6-19-15-11(8-18)12(9-20-15)10-4-5-13(16)14(17)7-10/h4-5,7,9H,2-3,6H2,1H3.
What are the key properties of 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile?
2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile has a molecular weight of 342.32 g/mol, XLogP of 6.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile is sourced from PubChem (CID 134107227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).