C19H20N6O — CID 134107785
N-[4-(benzylamino)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 134107785) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[4-(benzylamino)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-(benzylamino)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 134107785 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[4-(benzylamino)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | ONc1nc(NCc2ccccc2)nc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C19H20N6O/c26-24-18-21-17(20-12-14-6-2-1-3-7-14)22-19(23-18)25-11-10-15-8-4-5-9-16(15)13-25/h1-9,26H,10-13H2,(H2,20,21,22,23,24) |
| InChIKey | WERGPZHLZCNMII-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|