C24H28FN7O — CID 134107936
N'-[4-(cyclohexylmethylamino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]benzohydrazide (PubChem CID 134107936) has the molecular formula C24H28FN7O and a molecular weight of 449.53 g/mol. Its IUPAC name is N'-[4-(cyclohexylmethylamino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]benzohydrazide.
| Compound Name | N'-[4-(cyclohexylmethylamino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 134107936 |
| Molecular Formula | C24H28FN7O |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N'-[4-(cyclohexylmethylamino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]benzohydrazide |
| SMILES | O=C(NNc1nc(NCc2ccccc2F)nc(NCC2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H28FN7O/c25-20-14-8-7-13-19(20)16-27-23-28-22(26-15-17-9-3-1-4-10-17)29-24(30-23)32-31-21(33)18-11-5-2-6-12-18/h2,5-8,11-14,17H,1,3-4,9-10,15-16H2,(H,31,33)(H3,26,27,28,29,30,32) |
| InChIKey | DGTNYLIDZYXNKJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|